C18H18ClNO3 — CID 141186814
4-[2-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]propyl]benzene-1,2-diol (PubChem CID 141186814) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is 4-[2-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]propyl]benzene-1,2-diol.
| Compound Name | 4-[2-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]propyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 141186814 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 4-[2-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]propyl]benzene-1,2-diol |
| SMILES | CC(Cc1ccc(O)c(O)c1)C1=NOC(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H18ClNO3/c1-11(7-12-5-6-16(21)17(22)8-12)15-10-18(23-20-15)13-3-2-4-14(19)9-13/h2-6,8-9,11,18,21-22H,7,10H2,1H3 |
| InChIKey | CGUXCWZGLWPJDZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|