C17H20N6O — CID 141187215
2-N-[(1S,2S)-2-phenylmethoxycyclopentyl]-7H-purine-2,6-diamine (PubChem CID 141187215) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-N-[(1S,2S)-2-phenylmethoxycyclopentyl]-7H-purine-2,6-diamine.
| Compound Name | 2-N-[(1S,2S)-2-phenylmethoxycyclopentyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 141187215 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-N-[(1S,2S)-2-phenylmethoxycyclopentyl]-7H-purine-2,6-diamine |
| SMILES | Nc1nc(N[C@H]2CCC[C@@H]2OCc2ccccc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C17H20N6O/c18-15-14-16(20-10-19-14)23-17(22-15)21-12-7-4-8-13(12)24-9-11-5-2-1-3-6-11/h1-3,5-6,10,12-13H,4,7-9H2,(H4,18,19,20,21,22,23)/t12-,13-/m0/s1 |
| InChIKey | SZDHELMCBFEQHX-STQMWFEESA-N |
| XLogP | 2.48 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |