About aniline;4-fluorobenzaldehyde
aniline;4-fluorobenzaldehyde (PubChem CID 141187411) has the molecular formula C13H12FNO
and a molecular weight of 217.24 g/mol. Its IUPAC name is aniline;4-fluorobenzaldehyde.
Molecular Properties
| Compound Name | aniline;4-fluorobenzaldehyde |
| PubChem CID | 141187411 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | aniline;4-fluorobenzaldehyde |
| SMILES | Nc1ccccc1.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H5FO.C6H7N/c8-7-3-1-6(5-9)2-4-7;7-6-4-2-1-3-5-6/h1-5H;1-5H,7H2 |
| InChIKey | XBSNAKITUBIZNC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;4-fluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;4-fluorobenzaldehyde?
The IUPAC name of aniline;4-fluorobenzaldehyde (CID 141187411) is aniline;4-fluorobenzaldehyde.
What is the SMILES notation for aniline;4-fluorobenzaldehyde?
The canonical SMILES for aniline;4-fluorobenzaldehyde is Nc1ccccc1.O=Cc1ccc(F)cc1.
What is the InChIKey of aniline;4-fluorobenzaldehyde?
The InChIKey is XBSNAKITUBIZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO.C6H7N/c8-7-3-1-6(5-9)2-4-7;7-6-4-2-1-3-5-6/h1-5H;1-5H,7H2.
What are the key properties of aniline;4-fluorobenzaldehyde?
aniline;4-fluorobenzaldehyde has a molecular weight of 217.24 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;4-fluorobenzaldehyde is sourced from PubChem (CID 141187411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).