C12H11N3O2 — CID 141187555
2-[1-(1,3-dioxol-2-ylmethyl)pyrazol-4-yl]pyridine (PubChem CID 141187555) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-[1-(1,3-dioxol-2-ylmethyl)pyrazol-4-yl]pyridine.
| Compound Name | 2-[1-(1,3-dioxol-2-ylmethyl)pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 141187555 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[1-(1,3-dioxol-2-ylmethyl)pyrazol-4-yl]pyridine |
| SMILES | C1=COC(Cn2cc(-c3ccccn3)cn2)O1 |
| InChI | InChI=1S/C12H11N3O2/c1-2-4-13-11(3-1)10-7-14-15(8-10)9-12-16-5-6-17-12/h1-8,12H,9H2 |
| InChIKey | BFTSFGCQUDHMJP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |