About 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one
1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 141187631) has the molecular formula C7H8N4O2S
and a molecular weight of 212.23 g/mol. Its IUPAC name is 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one.
Molecular Properties
| Compound Name | 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one |
| PubChem CID | 141187631 |
| Molecular Formula | C7H8N4O2S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | Cn1[nH]c(=O)c2cnc(S(C)=O)nc21 |
| InChI | InChI=1S/C7H8N4O2S/c1-11-5-4(6(12)10-11)3-8-7(9-5)14(2)13/h3H,1-2H3,(H,10,12) |
| InChIKey | YHRUARLJJNXWLL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one?
The IUPAC name of 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one (CID 141187631) is 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one.
What is the SMILES notation for 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one?
The canonical SMILES for 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one is Cn1[nH]c(=O)c2cnc(S(C)=O)nc21.
What is the InChIKey of 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one?
The InChIKey is YHRUARLJJNXWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2S/c1-11-5-4(6(12)10-11)3-8-7(9-5)14(2)13/h3H,1-2H3,(H,10,12).
What are the key properties of 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one?
1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one has a molecular weight of 212.23 g/mol, XLogP of -0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-methylsulfinyl-2H-pyrazolo[3,4-d]pyrimidin-3-one is sourced from PubChem (CID 141187631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).