About 3-(oxolan-2-yl)-1,2,4-thiadiazole
3-(oxolan-2-yl)-1,2,4-thiadiazole (PubChem CID 141188068) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 3-(oxolan-2-yl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-(oxolan-2-yl)-1,2,4-thiadiazole |
| PubChem CID | 141188068 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3-(oxolan-2-yl)-1,2,4-thiadiazole |
| SMILES | c1nc(C2CCCO2)ns1 |
| InChI | InChI=1S/C6H8N2OS/c1-2-5(9-3-1)6-7-4-10-8-6/h4-5H,1-3H2 |
| InChIKey | YTQNAJVYOYCFAB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(oxolan-2-yl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxolan-2-yl)-1,2,4-thiadiazole?
The IUPAC name of 3-(oxolan-2-yl)-1,2,4-thiadiazole (CID 141188068) is 3-(oxolan-2-yl)-1,2,4-thiadiazole.
What is the SMILES notation for 3-(oxolan-2-yl)-1,2,4-thiadiazole?
The canonical SMILES for 3-(oxolan-2-yl)-1,2,4-thiadiazole is c1nc(C2CCCO2)ns1.
What is the InChIKey of 3-(oxolan-2-yl)-1,2,4-thiadiazole?
The InChIKey is YTQNAJVYOYCFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-2-5(9-3-1)6-7-4-10-8-6/h4-5H,1-3H2.
What are the key properties of 3-(oxolan-2-yl)-1,2,4-thiadiazole?
3-(oxolan-2-yl)-1,2,4-thiadiazole has a molecular weight of 156.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-2-yl)-1,2,4-thiadiazole is sourced from PubChem (CID 141188068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).