C7H6IN3O — CID 141188190
1-iodo-3,4-dihydropyrido[2,3-b]pyrazin-2-one (PubChem CID 141188190) has the molecular formula C7H6IN3O and a molecular weight of 275.05 g/mol. Its IUPAC name is 1-iodo-3,4-dihydropyrido[2,3-b]pyrazin-2-one.
| Compound Name | 1-iodo-3,4-dihydropyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 141188190 |
| Molecular Formula | C7H6IN3O |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 1-iodo-3,4-dihydropyrido[2,3-b]pyrazin-2-one |
| SMILES | O=C1CNc2ncccc2N1I |
| InChI | InChI=1S/C7H6IN3O/c8-11-5-2-1-3-9-7(5)10-4-6(11)12/h1-3H,4H2,(H,9,10) |
| InChIKey | LLPZHPQBAVLCQP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|