C15H12F4IN3 — CID 141188195
1-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7-iodo-3,4-dihydro-2H-pyrido[2,3-b]pyrazine (PubChem CID 141188195) has the molecular formula C15H12F4IN3 and a molecular weight of 437.18 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7-iodo-3,4-dihydro-2H-pyrido[2,3-b]pyrazine.
| Compound Name | 1-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7-iodo-3,4-dihydro-2H-pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 141188195 |
| Molecular Formula | C15H12F4IN3 |
| Molecular Weight | 437.18 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 1-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-7-iodo-3,4-dihydro-2H-pyrido[2,3-b]pyrazine |
| SMILES | Fc1ccc(C(F)(F)F)c(CN2CCNc3ncc(I)cc32)c1 |
| InChI | InChI=1S/C15H12F4IN3/c16-10-1-2-12(15(17,18)19)9(5-10)8-23-4-3-21-14-13(23)6-11(20)7-22-14/h1-2,5-7H,3-4,8H2,(H,21,22) |
| InChIKey | ISEOUHMNSPIOLH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|