About bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate
bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate (PubChem CID 141188246) has the molecular formula C13H32N2O5S
and a molecular weight of 328.48 g/mol. Its IUPAC name is bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate.
Molecular Properties
| Compound Name | bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate |
| PubChem CID | 141188246 |
| Molecular Formula | C13H32N2O5S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate |
| SMILES | CCC=C(C)C(=O)[O-].CCCS(=O)(=O)[O-].C[NH2+]C.C[NH2+]C |
| InChI | InChI=1S/C6H10O2.C3H8O3S.2C2H7N/c1-3-4-5(2)6(7)8;1-2-3-7(4,5)6;2*1-3-2/h4H,3H2,1-2H3,(H,7,8);2-3H2,1H3,(H,4,5,6);2*3H,1-2H3 |
| InChIKey | GYYDPOXFZHUZRO-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate?
The IUPAC name of bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate (CID 141188246) is bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate.
What is the SMILES notation for bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate?
The canonical SMILES for bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate is CCC=C(C)C(=O)[O-].CCCS(=O)(=O)[O-].C[NH2+]C.C[NH2+]C.
What is the InChIKey of bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate?
The InChIKey is GYYDPOXFZHUZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C3H8O3S.2C2H7N/c1-3-4-5(2)6(7)8;1-2-3-7(4,5)6;2*1-3-2/h4H,3H2,1-2H3,(H,7,8);2-3H2,1H3,(H,4,5,6);2*3H,1-2H3.
What are the key properties of bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate?
bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate has a molecular weight of 328.48 g/mol, XLogP of -2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dimethylazanium);2-methylpent-2-enoate;propane-1-sulfonate is sourced from PubChem (CID 141188246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).