C4H9IN4 — CID 141188276
1-iodo-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine (PubChem CID 141188276) has the molecular formula C4H9IN4 and a molecular weight of 240.05 g/mol. Its IUPAC name is 1-iodo-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine.
| Compound Name | 1-iodo-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 141188276 |
| Molecular Formula | C4H9IN4 |
| Molecular Weight | 240.05 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 1-iodo-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine |
| SMILES | NN(I)C1=NCCCN1 |
| InChI | InChI=1S/C4H9IN4/c5-9(6)4-7-2-1-3-8-4/h1-3,6H2,(H,7,8) |
| InChIKey | VWTJCDOPOSUSHV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.05 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|