About 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one
1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one (PubChem CID 141188393) has the molecular formula C6H4IN3O
and a molecular weight of 261.02 g/mol. Its IUPAC name is 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one.
Molecular Properties
| Compound Name | 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one |
| PubChem CID | 141188393 |
| Molecular Formula | C6H4IN3O |
| Molecular Weight | 261.02 g/mol |
| Exact Mass | 260.94 |
| IUPAC Name | 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one |
| SMILES | O=c1cc[nH]c2c1cnn2I |
| InChI | InChI=1S/C6H4IN3O/c7-10-6-4(3-9-10)5(11)1-2-8-6/h1-3H,(H,8,11) |
| InChIKey | RTOVILKKULARJZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.02 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one?
The IUPAC name of 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one (CID 141188393) is 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one.
What is the SMILES notation for 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one?
The canonical SMILES for 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one is O=c1cc[nH]c2c1cnn2I.
What is the InChIKey of 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one?
The InChIKey is RTOVILKKULARJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4IN3O/c7-10-6-4(3-9-10)5(11)1-2-8-6/h1-3H,(H,8,11).
What are the key properties of 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one?
1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one has a molecular weight of 261.02 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-7H-pyrazolo[5,4-b]pyridin-4-one is sourced from PubChem (CID 141188393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).