About [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate
[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate (PubChem CID 141188498) has the molecular formula C18H10BrF9N2O
and a molecular weight of 521.18 g/mol. Its IUPAC name is [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate.
Molecular Properties
| Compound Name | [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate |
| PubChem CID | 141188498 |
| Molecular Formula | C18H10BrF9N2O |
| Molecular Weight | 521.18 g/mol |
| Exact Mass | 519.98 |
| IUPAC Name | [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate |
| SMILES | N#CON(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C18H10BrF9N2O/c19-15-2-1-12(16(20,21)22)5-11(15)8-30(31-9-29)7-10-3-13(17(23,24)25)6-14(4-10)18(26,27)28/h1-6H,7-8H2 |
| InChIKey | IMNTXWIRWDEOMM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.18 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate?
The IUPAC name of [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate (CID 141188498) is [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate.
What is the SMILES notation for [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate?
The canonical SMILES for [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate is N#CON(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc(C(F)(F)F)ccc1Br.
What is the InChIKey of [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate?
The InChIKey is IMNTXWIRWDEOMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10BrF9N2O/c19-15-2-1-12(16(20,21)22)5-11(15)8-30(31-9-29)7-10-3-13(17(23,24)25)6-14(4-10)18(26,27)28/h1-6H,7-8H2.
What are the key properties of [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate?
[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate has a molecular weight of 521.18 g/mol, XLogP of 6.92, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]amino] cyanate is sourced from PubChem (CID 141188498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).