About 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid
5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid (PubChem CID 141188862) has the molecular formula C25H20F2N2O3
and a molecular weight of 434.44 g/mol. Its IUPAC name is 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid |
| PubChem CID | 141188862 |
| Molecular Formula | C25H20F2N2O3 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(CCc2ccccc2)c2cc(F)c(F)c(NCc3ccccc3)c2c1=O |
| InChI | InChI=1S/C25H20F2N2O3/c26-19-13-20-21(23(22(19)27)28-14-17-9-5-2-6-10-17)24(30)18(25(31)32)15-29(20)12-11-16-7-3-1-4-8-16/h1-10,13,15,28H,11-12,14H2,(H,31,32) |
| InChIKey | LVLVWFATUZSHOZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid?
The IUPAC name of 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid (CID 141188862) is 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid.
What is the SMILES notation for 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid?
The canonical SMILES for 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid is O=C(O)c1cn(CCc2ccccc2)c2cc(F)c(F)c(NCc3ccccc3)c2c1=O.
What is the InChIKey of 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid?
The InChIKey is LVLVWFATUZSHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F2N2O3/c26-19-13-20-21(23(22(19)27)28-14-17-9-5-2-6-10-17)24(30)18(25(31)32)15-29(20)12-11-16-7-3-1-4-8-16/h1-10,13,15,28H,11-12,14H2,(H,31,32).
What are the key properties of 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid?
5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid has a molecular weight of 434.44 g/mol, XLogP of 4.83, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzylamino)-6,7-difluoro-4-oxo-1-(2-phenylethyl)quinoline-3-carboxylic acid is sourced from PubChem (CID 141188862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).