C18H14F5NO2 — CID 141188870
2-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-1-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 141188870) has the molecular formula C18H14F5NO2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 2-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-1-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | 2-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-1-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 141188870 |
| Molecular Formula | C18H14F5NO2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-1-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | C=C(CN[C@H](CO)c1ccccc1)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H14F5NO2/c1-9(7-24-11(8-25)10-5-3-2-4-6-10)18(26)12-13(19)15(21)17(23)16(22)14(12)20/h2-6,11,24-25H,1,7-8H2/t11-/m1/s1 |
| InChIKey | AGRVOLSQVSSYBZ-LLVKDONJSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|