C19H22FNO4 — CID 141189042
2-(2-fluorophenyl)ethyl-[[5-(2-hydroxyethyl)-2-methoxyphenyl]methyl]carbamic acid (PubChem CID 141189042) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-(2-fluorophenyl)ethyl-[[5-(2-hydroxyethyl)-2-methoxyphenyl]methyl]carbamic acid.
| Compound Name | 2-(2-fluorophenyl)ethyl-[[5-(2-hydroxyethyl)-2-methoxyphenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 141189042 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(2-fluorophenyl)ethyl-[[5-(2-hydroxyethyl)-2-methoxyphenyl]methyl]carbamic acid |
| SMILES | COc1ccc(CCO)cc1CN(CCc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C19H22FNO4/c1-25-18-7-6-14(9-11-22)12-16(18)13-21(19(23)24)10-8-15-4-2-3-5-17(15)20/h2-7,12,22H,8-11,13H2,1H3,(H,23,24) |
| InChIKey | CQSZZMKLOQBAJQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |