About 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole
1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole (PubChem CID 141189279) has the molecular formula C12H16F2N2
and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole.
Molecular Properties
| Compound Name | 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole |
| PubChem CID | 141189279 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole |
| SMILES | FC(F)=CCC(C1CCCC1)n1cccn1 |
| InChI | InChI=1S/C12H16F2N2/c13-12(14)7-6-11(10-4-1-2-5-10)16-9-3-8-15-16/h3,7-11H,1-2,4-6H2 |
| InChIKey | CYNRIBAHEKGTDY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole?
The IUPAC name of 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole (CID 141189279) is 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole.
What is the SMILES notation for 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole?
The canonical SMILES for 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole is FC(F)=CCC(C1CCCC1)n1cccn1.
What is the InChIKey of 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole?
The InChIKey is CYNRIBAHEKGTDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2/c13-12(14)7-6-11(10-4-1-2-5-10)16-9-3-8-15-16/h3,7-11H,1-2,4-6H2.
What are the key properties of 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole?
1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole has a molecular weight of 226.27 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazole is sourced from PubChem (CID 141189279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).