C36H47ClN2 — CID 141189852
5-(5-chloro-7-heptylnaphthalen-1-yl)-2-(4-ethyl-2-octylphenyl)-1H-imidazole (PubChem CID 141189852) has the molecular formula C36H47ClN2 and a molecular weight of 543.24 g/mol. Its IUPAC name is 5-(5-chloro-7-heptylnaphthalen-1-yl)-2-(4-ethyl-2-octylphenyl)-1H-imidazole.
| Compound Name | 5-(5-chloro-7-heptylnaphthalen-1-yl)-2-(4-ethyl-2-octylphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 141189852 |
| Molecular Formula | C36H47ClN2 |
| Molecular Weight | 543.24 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 5-(5-chloro-7-heptylnaphthalen-1-yl)-2-(4-ethyl-2-octylphenyl)-1H-imidazole |
| SMILES | CCCCCCCCc1cc(CC)ccc1-c1ncc(-c2cccc3c(Cl)cc(CCCCCCC)cc23)[nH]1 |
| InChI | InChI=1S/C36H47ClN2/c1-4-7-9-11-13-15-18-29-23-27(6-3)21-22-30(29)36-38-26-35(39-36)32-20-16-19-31-33(32)24-28(25-34(31)37)17-14-12-10-8-5-2/h16,19-26H,4-15,17-18H2,1-3H3,(H,38,39) |
| InChIKey | ICSVOXAHODGUAO-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.24 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|