About 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole
3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole (PubChem CID 141189971) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole |
| PubChem CID | 141189971 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole |
| SMILES | COCCN1CSC(C)=C1C |
| InChI | InChI=1S/C8H15NOS/c1-7-8(2)11-6-9(7)4-5-10-3/h4-6H2,1-3H3 |
| InChIKey | SNACTVLZNFKCLB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole?
The IUPAC name of 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole (CID 141189971) is 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole.
What is the SMILES notation for 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole?
The canonical SMILES for 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole is COCCN1CSC(C)=C1C.
What is the InChIKey of 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole?
The InChIKey is SNACTVLZNFKCLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS/c1-7-8(2)11-6-9(7)4-5-10-3/h4-6H2,1-3H3.
What are the key properties of 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole?
3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole has a molecular weight of 173.28 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyethyl)-4,5-dimethyl-2H-1,3-thiazole is sourced from PubChem (CID 141189971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).