C12H14O4 — CID 141190151
4,5-dihydroxy-1-phenylmethoxypent-1-en-3-one (PubChem CID 141190151) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4,5-dihydroxy-1-phenylmethoxypent-1-en-3-one.
| Compound Name | 4,5-dihydroxy-1-phenylmethoxypent-1-en-3-one |
|---|---|
| PubChem CID | 141190151 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4,5-dihydroxy-1-phenylmethoxypent-1-en-3-one |
| SMILES | O=C(C=COCc1ccccc1)C(O)CO |
| InChI | InChI=1S/C12H14O4/c13-8-12(15)11(14)6-7-16-9-10-4-2-1-3-5-10/h1-7,12-13,15H,8-9H2 |
| InChIKey | MALMSNRBGAIAQT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|