About 3-hydroxypropanoic acid;prop-1-ene
3-hydroxypropanoic acid;prop-1-ene (PubChem CID 141190876) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-hydroxypropanoic acid;prop-1-ene.
Molecular Properties
| Compound Name | 3-hydroxypropanoic acid;prop-1-ene |
| PubChem CID | 141190876 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 3-hydroxypropanoic acid;prop-1-ene |
| SMILES | C=CC.O=C(O)CCO |
| InChI | InChI=1S/C3H6O3.C3H6/c4-2-1-3(5)6;1-3-2/h4H,1-2H2,(H,5,6);3H,1H2,2H3 |
| InChIKey | RMXWUXQRRHUGQP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropanoic acid;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropanoic acid;prop-1-ene?
The IUPAC name of 3-hydroxypropanoic acid;prop-1-ene (CID 141190876) is 3-hydroxypropanoic acid;prop-1-ene.
What is the SMILES notation for 3-hydroxypropanoic acid;prop-1-ene?
The canonical SMILES for 3-hydroxypropanoic acid;prop-1-ene is C=CC.O=C(O)CCO.
What is the InChIKey of 3-hydroxypropanoic acid;prop-1-ene?
The InChIKey is RMXWUXQRRHUGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C3H6/c4-2-1-3(5)6;1-3-2/h4H,1-2H2,(H,5,6);3H,1H2,2H3.
What are the key properties of 3-hydroxypropanoic acid;prop-1-ene?
3-hydroxypropanoic acid;prop-1-ene has a molecular weight of 132.16 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropanoic acid;prop-1-ene is sourced from PubChem (CID 141190876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).