About 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one
1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one (PubChem CID 141191263) has the molecular formula C15H11F3N2O3S
and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one.
Molecular Properties
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one |
| PubChem CID | 141191263 |
| Molecular Formula | C15H11F3N2O3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one |
| SMILES | Cc1csc(-n2ccc(OCc3ccc(C(F)(F)F)o3)cc2=O)n1 |
| InChI | InChI=1S/C15H11F3N2O3S/c1-9-8-24-14(19-9)20-5-4-10(6-13(20)21)22-7-11-2-3-12(23-11)15(16,17)18/h2-6,8H,7H2,1H3 |
| InChIKey | BRHJNEVJOMYZGU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one?
The IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one (CID 141191263) is 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one.
What is the SMILES notation for 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one?
The canonical SMILES for 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one is Cc1csc(-n2ccc(OCc3ccc(C(F)(F)F)o3)cc2=O)n1.
What is the InChIKey of 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one?
The InChIKey is BRHJNEVJOMYZGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N2O3S/c1-9-8-24-14(19-9)20-5-4-10(6-13(20)21)22-7-11-2-3-12(23-11)15(16,17)18/h2-6,8H,7H2,1H3.
What are the key properties of 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one?
1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one has a molecular weight of 356.33 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,3-thiazol-2-yl)-4-[[5-(trifluoromethyl)furan-2-yl]methoxy]pyridin-2-one is sourced from PubChem (CID 141191263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).