About 2-(2-nitroethyl)-4,7-dihydro-1H-indole
2-(2-nitroethyl)-4,7-dihydro-1H-indole (PubChem CID 141191570) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(2-nitroethyl)-4,7-dihydro-1H-indole.
Molecular Properties
| Compound Name | 2-(2-nitroethyl)-4,7-dihydro-1H-indole |
| PubChem CID | 141191570 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(2-nitroethyl)-4,7-dihydro-1H-indole |
| SMILES | O=[N+]([O-])CCc1cc2c([nH]1)CC=CC2 |
| InChI | InChI=1S/C10H12N2O2/c13-12(14)6-5-9-7-8-3-1-2-4-10(8)11-9/h1-2,7,11H,3-6H2 |
| InChIKey | NCTKKWMSNFGXQS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitroethyl)-4,7-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitroethyl)-4,7-dihydro-1H-indole?
The IUPAC name of 2-(2-nitroethyl)-4,7-dihydro-1H-indole (CID 141191570) is 2-(2-nitroethyl)-4,7-dihydro-1H-indole.
What is the SMILES notation for 2-(2-nitroethyl)-4,7-dihydro-1H-indole?
The canonical SMILES for 2-(2-nitroethyl)-4,7-dihydro-1H-indole is O=[N+]([O-])CCc1cc2c([nH]1)CC=CC2.
What is the InChIKey of 2-(2-nitroethyl)-4,7-dihydro-1H-indole?
The InChIKey is NCTKKWMSNFGXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c13-12(14)6-5-9-7-8-3-1-2-4-10(8)11-9/h1-2,7,11H,3-6H2.
What are the key properties of 2-(2-nitroethyl)-4,7-dihydro-1H-indole?
2-(2-nitroethyl)-4,7-dihydro-1H-indole has a molecular weight of 192.22 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitroethyl)-4,7-dihydro-1H-indole is sourced from PubChem (CID 141191570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).