C14H10BrFN4O — CID 141191629
1-[4-amino-5-(3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-bromoethanone (PubChem CID 141191629) has the molecular formula C14H10BrFN4O and a molecular weight of 349.16 g/mol. Its IUPAC name is 1-[4-amino-5-(3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-bromoethanone.
| Compound Name | 1-[4-amino-5-(3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-bromoethanone |
|---|---|
| PubChem CID | 141191629 |
| Molecular Formula | C14H10BrFN4O |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-[4-amino-5-(3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-bromoethanone |
| SMILES | Nc1ncnn2c(C(=O)CBr)cc(-c3cccc(F)c3)c12 |
| InChI | InChI=1S/C14H10BrFN4O/c15-6-12(21)11-5-10(8-2-1-3-9(16)4-8)13-14(17)18-7-19-20(11)13/h1-5,7H,6H2,(H2,17,18,19) |
| InChIKey | REKZBXALKNJEGS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|