C17H20FNO4 — CID 141191784
2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 141191784) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 141191784 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2CC(F)C[C@@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20FNO4/c1-22-16(20)15-14-8-13(18)7-12(14)9-19(15)17(21)23-10-11-5-3-2-4-6-11/h2-6,12-15H,7-10H2,1H3/t12-,13?,14-,15+/m1/s1 |
| InChIKey | DSHPDRFDNAAHFS-FFHGMXDLSA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |