C10H9F11 — CID 141192184
5,5,6,6,7,7,8,8,9,9,9-undecafluoro-3-methylnon-2-ene (PubChem CID 141192184) has the molecular formula C10H9F11 and a molecular weight of 338.16 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,9-undecafluoro-3-methylnon-2-ene.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,9-undecafluoro-3-methylnon-2-ene |
|---|---|
| PubChem CID | 141192184 |
| Molecular Formula | C10H9F11 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,9-undecafluoro-3-methylnon-2-ene |
| SMILES | CC=C(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F11/c1-3-5(2)4-6(11,12)7(13,14)8(15,16)9(17,18)10(19,20)21/h3H,4H2,1-2H3 |
| InChIKey | IDHJMJFGZAJQDX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|