C11H13N5O2S — CID 141192257
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-sulfanyl-2,7-dihydro-1H-purin-6-one (PubChem CID 141192257) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-sulfanyl-2,7-dihydro-1H-purin-6-one.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-sulfanyl-2,7-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 141192257 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-sulfanyl-2,7-dihydro-1H-purin-6-one |
| SMILES | Cc1noc(C)c1CN1c2nc[nH]c2C(=O)NC1S |
| InChI | InChI=1S/C11H13N5O2S/c1-5-7(6(2)18-15-5)3-16-9-8(12-4-13-9)10(17)14-11(16)19/h4,11,19H,3H2,1-2H3,(H,12,13)(H,14,17) |
| InChIKey | ADLAJSNIJLIMGQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|