C26H43NO — CID 141192379
(3R,5R,7R,8S,9S,10R,13S,14S)-7,10,13-trimethyl-3-[(Z)-2-[(3R)-pyrrolidin-3-yl]ethenyl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol (PubChem CID 141192379) has the molecular formula C26H43NO and a molecular weight of 385.64 g/mol. Its IUPAC name is (3R,5R,7R,8S,9S,10R,13S,14S)-7,10,13-trimethyl-3-[(Z)-2-[(3R)-pyrrolidin-3-yl]ethenyl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol.
| Compound Name | (3R,5R,7R,8S,9S,10R,13S,14S)-7,10,13-trimethyl-3-[(Z)-2-[(3R)-pyrrolidin-3-yl]ethenyl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 141192379 |
| Molecular Formula | C26H43NO |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | (3R,5R,7R,8S,9S,10R,13S,14S)-7,10,13-trimethyl-3-[(Z)-2-[(3R)-pyrrolidin-3-yl]ethenyl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol |
| SMILES | C[C@@H]1C[C@@]2(O)C[C@H](/C=C\[C@H]3CCNC3)CC[C@]2(C)[C@H]2CC[C@]3(C)CCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H43NO/c1-18-15-26(28)16-19(6-7-20-10-14-27-17-20)8-13-25(26,3)22-9-12-24(2)11-4-5-21(24)23(18)22/h6-7,18-23,27-28H,4-5,8-17H2,1-3H3/b7-6-/t18-,19-,20+,21+,22+,23+,24+,25-,26-/m1/s1 |
| InChIKey | JKKUWAAXADXBGG-YWLYQHAVSA-N |
| XLogP | 5.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|