C14H16F5N3O — CID 141192957
N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine-2-carboxamide (PubChem CID 141192957) has the molecular formula C14H16F5N3O and a molecular weight of 337.29 g/mol. Its IUPAC name is N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine-2-carboxamide.
| Compound Name | N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 141192957 |
| Molecular Formula | C14H16F5N3O |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)C(F)(F)F)cc1)C1CNCCN1 |
| InChI | InChI=1S/C14H16F5N3O/c15-13(16,14(17,18)19)10-3-1-9(2-4-10)7-22-12(23)11-8-20-5-6-21-11/h1-4,11,20-21H,5-8H2,(H,22,23) |
| InChIKey | FGRRDLHVPNVZCX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|