About 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol
4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol (PubChem CID 141193162) has the molecular formula C19H26O2
and a molecular weight of 286.41 g/mol. Its IUPAC name is 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol |
| PubChem CID | 141193162 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol |
| SMILES | CC1(C)CC=C(c2cccc(C3(O)CCOCC3)c2)CC1 |
| InChI | InChI=1S/C19H26O2/c1-18(2)8-6-15(7-9-18)16-4-3-5-17(14-16)19(20)10-12-21-13-11-19/h3-6,14,20H,7-13H2,1-2H3 |
| InChIKey | AIIKXKBIZMKPHZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol?
The IUPAC name of 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol (CID 141193162) is 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol.
What is the SMILES notation for 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol?
The canonical SMILES for 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol is CC1(C)CC=C(c2cccc(C3(O)CCOCC3)c2)CC1.
What is the InChIKey of 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol?
The InChIKey is AIIKXKBIZMKPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O2/c1-18(2)8-6-15(7-9-18)16-4-3-5-17(14-16)19(20)10-12-21-13-11-19/h3-6,14,20H,7-13H2,1-2H3.
What are the key properties of 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol?
4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol has a molecular weight of 286.41 g/mol, XLogP of 4.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxan-4-ol is sourced from PubChem (CID 141193162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).