About (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine
(2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine (PubChem CID 141193185) has the molecular formula C21H25N
and a molecular weight of 291.44 g/mol. Its IUPAC name is (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine.
Molecular Properties
| Compound Name | (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine |
| PubChem CID | 141193185 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine |
| SMILES | C[C@H]1CCCN1C[C@@H]1C[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25N/c1-16-6-5-13-22(16)15-20-14-21(20)19-11-9-18(10-12-19)17-7-3-2-4-8-17/h2-4,7-12,16,20-21H,5-6,13-15H2,1H3/t16-,20-,21-/m0/s1 |
| InChIKey | LJBRVSGQYJDQEB-NDXORKPFSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine?
The IUPAC name of (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine (CID 141193185) is (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine.
What is the SMILES notation for (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine?
The canonical SMILES for (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine is C[C@H]1CCCN1C[C@@H]1C[C@H]1c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine?
The InChIKey is LJBRVSGQYJDQEB-NDXORKPFSA-N. The full InChI is InChI=1S/C21H25N/c1-16-6-5-13-22(16)15-20-14-21(20)19-11-9-18(10-12-19)17-7-3-2-4-8-17/h2-4,7-12,16,20-21H,5-6,13-15H2,1H3/t16-,20-,21-/m0/s1.
What are the key properties of (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine?
(2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine has a molecular weight of 291.44 g/mol, XLogP of 4.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-1-[[(1R,2R)-2-(4-phenylphenyl)cyclopropyl]methyl]pyrrolidine is sourced from PubChem (CID 141193185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).