C15H16N4OS — CID 141193568
4-[[2-methyl-5-(1-methyltriazol-4-yl)phenoxy]methyl]thiophen-3-amine (PubChem CID 141193568) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 4-[[2-methyl-5-(1-methyltriazol-4-yl)phenoxy]methyl]thiophen-3-amine.
| Compound Name | 4-[[2-methyl-5-(1-methyltriazol-4-yl)phenoxy]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 141193568 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-[[2-methyl-5-(1-methyltriazol-4-yl)phenoxy]methyl]thiophen-3-amine |
| SMILES | Cc1ccc(-c2cn(C)nn2)cc1OCc1cscc1N |
| InChI | InChI=1S/C15H16N4OS/c1-10-3-4-11(14-6-19(2)18-17-14)5-15(10)20-7-12-8-21-9-13(12)16/h3-6,8-9H,7,16H2,1-2H3 |
| InChIKey | CBUABSZGUPNGII-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |