About 1H-inden-5-ylhydrazine
1H-inden-5-ylhydrazine (PubChem CID 141194274) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1H-inden-5-ylhydrazine.
Molecular Properties
| Compound Name | 1H-inden-5-ylhydrazine |
| PubChem CID | 141194274 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1H-inden-5-ylhydrazine |
| SMILES | NNc1ccc2c(c1)C=CC2 |
| InChI | InChI=1S/C9H10N2/c10-11-9-5-4-7-2-1-3-8(7)6-9/h1,3-6,11H,2,10H2 |
| InChIKey | JQNYRDSCMLHUDF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-5-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-5-ylhydrazine?
The IUPAC name of 1H-inden-5-ylhydrazine (CID 141194274) is 1H-inden-5-ylhydrazine.
What is the SMILES notation for 1H-inden-5-ylhydrazine?
The canonical SMILES for 1H-inden-5-ylhydrazine is NNc1ccc2c(c1)C=CC2.
What is the InChIKey of 1H-inden-5-ylhydrazine?
The InChIKey is JQNYRDSCMLHUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c10-11-9-5-4-7-2-1-3-8(7)6-9/h1,3-6,11H,2,10H2.
What are the key properties of 1H-inden-5-ylhydrazine?
1H-inden-5-ylhydrazine has a molecular weight of 146.19 g/mol, XLogP of 1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-5-ylhydrazine is sourced from PubChem (CID 141194274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).