C10H9F3O2 — CID 141194497
2-(trifluoromethyl)-2,3,4,7-tetrahydrochromen-6-one (PubChem CID 141194497) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is 2-(trifluoromethyl)-2,3,4,7-tetrahydrochromen-6-one.
| Compound Name | 2-(trifluoromethyl)-2,3,4,7-tetrahydrochromen-6-one |
|---|---|
| PubChem CID | 141194497 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-(trifluoromethyl)-2,3,4,7-tetrahydrochromen-6-one |
| SMILES | O=C1C=C2CCC(C(F)(F)F)OC2=CC1 |
| InChI | InChI=1S/C10H9F3O2/c11-10(12,13)9-4-1-6-5-7(14)2-3-8(6)15-9/h3,5,9H,1-2,4H2 |
| InChIKey | ZQVXKVUWCXKXLT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |