C39H25N5O2S2 — CID 141194503
3-(1-benzofuran-2-yl)-5-(9H-carbazol-1-yl)-4-(1H-imidazol-2-yl)-2-naphthalen-1-ylsulfanyl-3-(1,3-thiazol-2-yl)-1,2-oxazole (PubChem CID 141194503) has the molecular formula C39H25N5O2S2 and a molecular weight of 659.80 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-5-(9H-carbazol-1-yl)-4-(1H-imidazol-2-yl)-2-naphthalen-1-ylsulfanyl-3-(1,3-thiazol-2-yl)-1,2-oxazole.
| Compound Name | 3-(1-benzofuran-2-yl)-5-(9H-carbazol-1-yl)-4-(1H-imidazol-2-yl)-2-naphthalen-1-ylsulfanyl-3-(1,3-thiazol-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 141194503 |
| Molecular Formula | C39H25N5O2S2 |
| Molecular Weight | 659.80 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-5-(9H-carbazol-1-yl)-4-(1H-imidazol-2-yl)-2-naphthalen-1-ylsulfanyl-3-(1,3-thiazol-2-yl)-1,2-oxazole |
| SMILES | c1ccc2oc(C3(c4nccs4)C(c4ncc[nH]4)=C(c4cccc5c4[nH]c4ccccc45)ON3Sc3cccc4ccccc34)cc2c1 |
| InChI | InChI=1S/C39H25N5O2S2/c1-3-12-26-24(9-1)11-7-18-32(26)48-44-39(38-42-21-22-47-38,33-23-25-10-2-6-17-31(25)45-33)34(37-40-19-20-41-37)36(46-44)29-15-8-14-28-27-13-4-5-16-30(27)43-35(28)29/h1-23,43H,(H,40,41) |
| InChIKey | LOALIPGDVYJCOQ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.80 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|