C49H37N5S3 — CID 141195863
1-[5-(2,3-dihydroindol-1-yl)-2,4-bis(1H-indol-2-yl)-3-(2H-isoindol-1-yl)-6-(trithian-4-yl)phenyl]indolizine (PubChem CID 141195863) has the molecular formula C49H37N5S3 and a molecular weight of 792.07 g/mol. Its IUPAC name is 1-[5-(2,3-dihydroindol-1-yl)-2,4-bis(1H-indol-2-yl)-3-(2H-isoindol-1-yl)-6-(trithian-4-yl)phenyl]indolizine.
| Compound Name | 1-[5-(2,3-dihydroindol-1-yl)-2,4-bis(1H-indol-2-yl)-3-(2H-isoindol-1-yl)-6-(trithian-4-yl)phenyl]indolizine |
|---|---|
| PubChem CID | 141195863 |
| Molecular Formula | C49H37N5S3 |
| Molecular Weight | 792.07 g/mol |
| Exact Mass | 791.22 |
| IUPAC Name | 1-[5-(2,3-dihydroindol-1-yl)-2,4-bis(1H-indol-2-yl)-3-(2H-isoindol-1-yl)-6-(trithian-4-yl)phenyl]indolizine |
| SMILES | c1ccc2c(c1)CCN2c1c(-c2cc3ccccc3[nH]2)c(-c2[nH]cc3ccccc23)c(-c2cc3ccccc3[nH]2)c(-c2ccn3ccccc23)c1C1CCSSS1 |
| InChI | InChI=1S/C49H37N5S3/c1-5-15-34-33(14-1)29-50-48(34)47-44(38-27-31-12-2-6-16-36(31)51-38)43(35-21-24-53-23-10-9-19-41(35)53)46(42-22-26-55-57-56-42)49(54-25-20-30-11-4-8-18-40(30)54)45(47)39-28-32-13-3-7-17-37(32)52-39/h1-19,21,23-24,27-29,42,50-52H,20,22,25-26H2 |
| InChIKey | OAHCHQMGKVPRLU-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.07 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|