C30H22F6N2O6 — CID 141196141
5-[3,5-dimethyl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]-1,3-dimethyl-2-[4-nitro-2-(trifluoromethyl)phenoxy]benzene (PubChem CID 141196141) has the molecular formula C30H22F6N2O6 and a molecular weight of 620.50 g/mol. Its IUPAC name is 5-[3,5-dimethyl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]-1,3-dimethyl-2-[4-nitro-2-(trifluoromethyl)phenoxy]benzene.
| Compound Name | 5-[3,5-dimethyl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]-1,3-dimethyl-2-[4-nitro-2-(trifluoromethyl)phenoxy]benzene |
|---|---|
| PubChem CID | 141196141 |
| Molecular Formula | C30H22F6N2O6 |
| Molecular Weight | 620.50 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | 5-[3,5-dimethyl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]-1,3-dimethyl-2-[4-nitro-2-(trifluoromethyl)phenoxy]benzene |
| SMILES | Cc1cc(-c2cc(C)c(Oc3ccc([N+](=O)[O-])cc3C(F)(F)F)c(C)c2)cc(C)c1Oc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C30H22F6N2O6/c1-15-9-19(10-16(2)27(15)43-25-7-5-21(37(39)40)13-23(25)29(31,32)33)20-11-17(3)28(18(4)12-20)44-26-8-6-22(38(41)42)14-24(26)30(34,35)36/h5-14H,1-4H3 |
| InChIKey | WBLFBHGXUOXRTE-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.50 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|