About 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 141196255) has the molecular formula C8H10FN3O
and a molecular weight of 183.19 g/mol. Its IUPAC name is 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| PubChem CID | 141196255 |
| Molecular Formula | C8H10FN3O |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | FCCOc1ncc2c(n1)CNC2 |
| InChI | InChI=1S/C8H10FN3O/c9-1-2-13-8-11-4-6-3-10-5-7(6)12-8/h4,10H,1-3,5H2 |
| InChIKey | MKCOVWBYNPQIDN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The IUPAC name of 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (CID 141196255) is 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is FCCOc1ncc2c(n1)CNC2.
What is the InChIKey of 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The InChIKey is MKCOVWBYNPQIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN3O/c9-1-2-13-8-11-4-6-3-10-5-7(6)12-8/h4,10H,1-3,5H2.
What are the key properties of 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine has a molecular weight of 183.19 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethoxy)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 141196255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).