C20H5F15O — CID 141196647
4-[2,3,4,5-tetrafluoro-6-[2,3,4,5,6-pentafluoro-1,6-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]phenol (PubChem CID 141196647) has the molecular formula C20H5F15O and a molecular weight of 546.23 g/mol. Its IUPAC name is 4-[2,3,4,5-tetrafluoro-6-[2,3,4,5,6-pentafluoro-1,6-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]phenol.
| Compound Name | 4-[2,3,4,5-tetrafluoro-6-[2,3,4,5,6-pentafluoro-1,6-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]phenol |
|---|---|
| PubChem CID | 141196647 |
| Molecular Formula | C20H5F15O |
| Molecular Weight | 546.23 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | 4-[2,3,4,5-tetrafluoro-6-[2,3,4,5,6-pentafluoro-1,6-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]phenol |
| SMILES | Oc1ccc(-c2c(F)c(F)c(F)c(F)c2C2(C(F)(F)F)C(F)=C(F)C(F)=C(F)C2(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H5F15O/c21-9-7(5-1-3-6(36)4-2-5)8(10(22)12(24)11(9)23)17(19(30,31)32)15(27)13(25)14(26)16(28)18(17,29)20(33,34)35/h1-4,36H |
| InChIKey | OVFPUAAYXCOMLE-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.23 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|