C15H20N2O6S — CID 141196761
(2R,3S)-2-(5-amino-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid (PubChem CID 141196761) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2R,3S)-2-(5-amino-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid.
| Compound Name | (2R,3S)-2-(5-amino-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141196761 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2R,3S)-2-(5-amino-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid |
| SMILES | CC(C)S(=O)(=O)c1ccc(N)cc1[C@H]1[C@@H](C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C15H20N2O6S/c1-8(2)24(22,23)12-4-3-9(16)7-11(12)13-10(14(18)19)5-6-17(13)15(20)21/h3-4,7-8,10,13H,5-6,16H2,1-2H3,(H,18,19)(H,20,21)/t10-,13+/m0/s1 |
| InChIKey | ZKDXXBORPAUDTA-GXFFZTMASA-N |
| XLogP | 1.58 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|