About 2H-pyrrolo[1,2-a]pyrimidine-6-thione
2H-pyrrolo[1,2-a]pyrimidine-6-thione (PubChem CID 141197078) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 2H-pyrrolo[1,2-a]pyrimidine-6-thione.
Molecular Properties
| Compound Name | 2H-pyrrolo[1,2-a]pyrimidine-6-thione |
| PubChem CID | 141197078 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 2H-pyrrolo[1,2-a]pyrimidine-6-thione |
| SMILES | S=C1C=CC2=NCC=CN12 |
| InChI | InChI=1S/C7H6N2S/c10-7-3-2-6-8-4-1-5-9(6)7/h1-3,5H,4H2 |
| InChIKey | PIXBYIISIGPONT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrrolo[1,2-a]pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[1,2-a]pyrimidine-6-thione?
The IUPAC name of 2H-pyrrolo[1,2-a]pyrimidine-6-thione (CID 141197078) is 2H-pyrrolo[1,2-a]pyrimidine-6-thione.
What is the SMILES notation for 2H-pyrrolo[1,2-a]pyrimidine-6-thione?
The canonical SMILES for 2H-pyrrolo[1,2-a]pyrimidine-6-thione is S=C1C=CC2=NCC=CN12.
What is the InChIKey of 2H-pyrrolo[1,2-a]pyrimidine-6-thione?
The InChIKey is PIXBYIISIGPONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c10-7-3-2-6-8-4-1-5-9(6)7/h1-3,5H,4H2.
What are the key properties of 2H-pyrrolo[1,2-a]pyrimidine-6-thione?
2H-pyrrolo[1,2-a]pyrimidine-6-thione has a molecular weight of 150.21 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[1,2-a]pyrimidine-6-thione is sourced from PubChem (CID 141197078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).