About dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate
dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 141197241) has the molecular formula C10H14O5S2
and a molecular weight of 278.35 g/mol. Its IUPAC name is dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate |
| PubChem CID | 141197241 |
| Molecular Formula | C10H14O5S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COCCC1SC(C(=O)OC)=C(C(=O)OC)S1 |
| InChI | InChI=1S/C10H14O5S2/c1-13-5-4-6-16-7(9(11)14-2)8(17-6)10(12)15-3/h6H,4-5H2,1-3H3 |
| InChIKey | XHOBDBUHFWJPKW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate?
The IUPAC name of dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate (CID 141197241) is dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate.
What is the SMILES notation for dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate?
The canonical SMILES for dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate is COCCC1SC(C(=O)OC)=C(C(=O)OC)S1.
What is the InChIKey of dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate?
The InChIKey is XHOBDBUHFWJPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5S2/c1-13-5-4-6-16-7(9(11)14-2)8(17-6)10(12)15-3/h6H,4-5H2,1-3H3.
What are the key properties of dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate?
dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate has a molecular weight of 278.35 g/mol, XLogP of 1.39, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(2-methoxyethyl)-1,3-dithiole-4,5-dicarboxylate is sourced from PubChem (CID 141197241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).