About 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine
3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine (PubChem CID 141197335) has the molecular formula C12H14FNO
and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine.
Molecular Properties
| Compound Name | 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine |
| PubChem CID | 141197335 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine |
| SMILES | CCOC1=NCc2c(F)cccc2CC1 |
| InChI | InChI=1S/C12H14FNO/c1-2-15-12-7-6-9-4-3-5-11(13)10(9)8-14-12/h3-5H,2,6-8H2,1H3 |
| InChIKey | SXLANTYGVSQXJD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine?
The IUPAC name of 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine (CID 141197335) is 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine.
What is the SMILES notation for 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine?
The canonical SMILES for 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine is CCOC1=NCc2c(F)cccc2CC1.
What is the InChIKey of 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine?
The InChIKey is SXLANTYGVSQXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO/c1-2-15-12-7-6-9-4-3-5-11(13)10(9)8-14-12/h3-5H,2,6-8H2,1H3.
What are the key properties of 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine?
3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine has a molecular weight of 207.25 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-9-fluoro-4,5-dihydro-1H-2-benzazepine is sourced from PubChem (CID 141197335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).