About 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran
2-(oxolan-2-yl)-3,4-dihydro-2H-pyran (PubChem CID 141197710) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran |
| PubChem CID | 141197710 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran |
| SMILES | C1=COC(C2CCCO2)CC1 |
| InChI | InChI=1S/C9H14O2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h2,6,8-9H,1,3-5,7H2 |
| InChIKey | MDMLSQGYSQNKET-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran?
The IUPAC name of 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran (CID 141197710) is 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran is C1=COC(C2CCCO2)CC1.
What is the InChIKey of 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran?
The InChIKey is MDMLSQGYSQNKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h2,6,8-9H,1,3-5,7H2.
What are the key properties of 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran?
2-(oxolan-2-yl)-3,4-dihydro-2H-pyran has a molecular weight of 154.21 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 141197710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).