About cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+)
cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) (PubChem CID 141198221) has the molecular formula C15H20Ru
and a molecular weight of 301.40 g/mol. Its IUPAC name is cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+).
Molecular Properties
| Compound Name | cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) |
| PubChem CID | 141198221 |
| Molecular Formula | C15H20Ru |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) |
| SMILES | CC(C)[c-]1cccc1.[C-]1=CC=CCCC1.[Ru+2] |
| InChI | InChI=1S/C8H11.C7H9.Ru/c1-7(2)8-5-3-4-6-8;1-2-4-6-7-5-3-1;/h3-7H,1-2H3;1-3H,4,6-7H2;/q2*-1;+2 |
| InChIKey | HEPNULNEXXXKGJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+)?
The IUPAC name of cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) (CID 141198221) is cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+).
What is the SMILES notation for cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+)?
The canonical SMILES for cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) is CC(C)[c-]1cccc1.[C-]1=CC=CCCC1.[Ru+2].
What is the InChIKey of cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+)?
The InChIKey is HEPNULNEXXXKGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11.C7H9.Ru/c1-7(2)8-5-3-4-6-8;1-2-4-6-7-5-3-1;/h3-7H,1-2H3;1-3H,4,6-7H2;/q2*-1;+2.
What are the key properties of cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+)?
cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) has a molecular weight of 301.40 g/mol, XLogP of 4.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta-1,3-diene;5-propan-2-ylcyclopenta-1,3-diene;ruthenium(2+) is sourced from PubChem (CID 141198221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).