About 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine
2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine (PubChem CID 141199159) has the molecular formula C24H27ClN2O
and a molecular weight of 394.95 g/mol. Its IUPAC name is 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine |
| PubChem CID | 141199159 |
| Molecular Formula | C24H27ClN2O |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1cc(-c2ncccc2-c2ccccc2C)ccc1Cl |
| InChI | InChI=1S/C24H27ClN2O/c1-4-27(5-2)15-16-28-23-17-19(12-13-22(23)25)24-21(11-8-14-26-24)20-10-7-6-9-18(20)3/h6-14,17H,4-5,15-16H2,1-3H3 |
| InChIKey | PAQKCFUVGDAJMG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine?
The IUPAC name of 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine (CID 141199159) is 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine.
What is the SMILES notation for 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine?
The canonical SMILES for 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine is CCN(CC)CCOc1cc(-c2ncccc2-c2ccccc2C)ccc1Cl.
What is the InChIKey of 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine?
The InChIKey is PAQKCFUVGDAJMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27ClN2O/c1-4-27(5-2)15-16-28-23-17-19(12-13-22(23)25)24-21(11-8-14-26-24)20-10-7-6-9-18(20)3/h6-14,17H,4-5,15-16H2,1-3H3.
What are the key properties of 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine?
2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine has a molecular weight of 394.95 g/mol, XLogP of 6.10, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-5-[3-(2-methylphenyl)-2-pyridinyl]phenoxy]-N,N-diethylethanamine is sourced from PubChem (CID 141199159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).