C7H16N2O4 — CID 141199277
(2R,3S,4R,5S,6S)-2-(aminomethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 141199277) has the molecular formula C7H16N2O4 and a molecular weight of 192.22 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-2-(aminomethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6S)-2-(aminomethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 141199277 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-(aminomethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | NC[C@H]1N[C@@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H16N2O4/c8-1-3-5(11)7(13)6(12)4(2-10)9-3/h3-7,9-13H,1-2,8H2/t3-,4+,5+,6+,7-/m1/s1 |
| InChIKey | ZMADHHULLAGROC-PFCGLBSHSA-N |
| XLogP | -3.64 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |