C10H16N4O4S — CID 141199448
[(1S,2S,4R)-2-hydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]methyl sulfamate (PubChem CID 141199448) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is [(1S,2S,4R)-2-hydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2S,4R)-2-hydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 141199448 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [(1S,2S,4R)-2-hydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@@H]1C[C@@H](Nc2ccncn2)C[C@@H]1O |
| InChI | InChI=1S/C10H16N4O4S/c11-19(16,17)18-5-7-3-8(4-9(7)15)14-10-1-2-12-6-13-10/h1-2,6-9,15H,3-5H2,(H2,11,16,17)(H,12,13,14)/t7-,8+,9-/m0/s1 |
| InChIKey | MPAQIGSUTHBFBN-YIZRAAEISA-N |
| XLogP | -0.75 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |