About ethyl 2-cyanoiminoacetate
ethyl 2-cyanoiminoacetate (PubChem CID 141199779) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is ethyl 2-cyanoiminoacetate.
Molecular Properties
| Compound Name | ethyl 2-cyanoiminoacetate |
| PubChem CID | 141199779 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | ethyl 2-cyanoiminoacetate |
| SMILES | CCOC(=O)/C=N/C#N |
| InChI | InChI=1S/C5H6N2O2/c1-2-9-5(8)3-7-4-6/h3H,2H2,1H3/b7-3+ |
| InChIKey | KHQSMQNMOCIBKT-XVNBXDOJSA-N |
| XLogP | 0.10 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-cyanoiminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyanoiminoacetate?
The IUPAC name of ethyl 2-cyanoiminoacetate (CID 141199779) is ethyl 2-cyanoiminoacetate.
What is the SMILES notation for ethyl 2-cyanoiminoacetate?
The canonical SMILES for ethyl 2-cyanoiminoacetate is CCOC(=O)/C=N/C#N.
What is the InChIKey of ethyl 2-cyanoiminoacetate?
The InChIKey is KHQSMQNMOCIBKT-XVNBXDOJSA-N. The full InChI is InChI=1S/C5H6N2O2/c1-2-9-5(8)3-7-4-6/h3H,2H2,1H3/b7-3+.
What are the key properties of ethyl 2-cyanoiminoacetate?
ethyl 2-cyanoiminoacetate has a molecular weight of 126.11 g/mol, XLogP of 0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyanoiminoacetate is sourced from PubChem (CID 141199779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).