C18H38N2 — CID 141199868
1,2-di(hexan-3-yl)cyclohexane-1,2-diamine (PubChem CID 141199868) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is 1,2-di(hexan-3-yl)cyclohexane-1,2-diamine.
| Compound Name | 1,2-di(hexan-3-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 141199868 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 1,2-di(hexan-3-yl)cyclohexane-1,2-diamine |
| SMILES | CCCC(CC)C1(N)CCCCC1(N)C(CC)CCC |
| InChI | InChI=1S/C18H38N2/c1-5-11-15(7-3)17(19)13-9-10-14-18(17,20)16(8-4)12-6-2/h15-16H,5-14,19-20H2,1-4H3 |
| InChIKey | DSKOZTJXRIKVRE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |