About 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one
4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one (PubChem CID 141200271) has the molecular formula C13H13NOS
and a molecular weight of 231.32 g/mol. Its IUPAC name is 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one.
Molecular Properties
| Compound Name | 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one |
| PubChem CID | 141200271 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one |
| SMILES | O=C1CCC(c2cc3ncccc3s2)CC1 |
| InChI | InChI=1S/C13H13NOS/c15-10-5-3-9(4-6-10)13-8-11-12(16-13)2-1-7-14-11/h1-2,7-9H,3-6H2 |
| InChIKey | ZHMQIVIKTAQDPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one?
The IUPAC name of 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one (CID 141200271) is 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one.
What is the SMILES notation for 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one?
The canonical SMILES for 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one is O=C1CCC(c2cc3ncccc3s2)CC1.
What is the InChIKey of 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one?
The InChIKey is ZHMQIVIKTAQDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NOS/c15-10-5-3-9(4-6-10)13-8-11-12(16-13)2-1-7-14-11/h1-2,7-9H,3-6H2.
What are the key properties of 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one?
4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one has a molecular weight of 231.32 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thieno[3,2-b]pyridin-2-ylcyclohexan-1-one is sourced from PubChem (CID 141200271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).